About S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate
S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate (PubChem CID 170419643) has the molecular formula C13H27NOS
and a molecular weight of 245.43 g/mol. Its IUPAC name is S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate.
Molecular Properties
| Compound Name | S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate |
| PubChem CID | 170419643 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate |
| SMILES | CC(C)CCCNC(=O)SCCCC(C)C |
| InChI | InChI=1S/C13H27NOS/c1-11(2)7-5-9-14-13(15)16-10-6-8-12(3)4/h11-12H,5-10H2,1-4H3,(H,14,15) |
| InChIKey | UEVWCIMXXQXSHN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate?
The IUPAC name of S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate (CID 170419643) is S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate.
What is the SMILES notation for S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate?
The canonical SMILES for S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate is CC(C)CCCNC(=O)SCCCC(C)C.
What is the InChIKey of S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate?
The InChIKey is UEVWCIMXXQXSHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NOS/c1-11(2)7-5-9-14-13(15)16-10-6-8-12(3)4/h11-12H,5-10H2,1-4H3,(H,14,15).
What are the key properties of S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate?
S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate has a molecular weight of 245.43 g/mol, XLogP of 4.30, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylpentyl) N-(4-methylpentyl)carbamothioate is sourced from PubChem (CID 170419643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).