About S-propan-2-yl N-(3-methylbutyl)carbamothioate
S-propan-2-yl N-(3-methylbutyl)carbamothioate (PubChem CID 121263423) has the molecular formula C9H19NOS
and a molecular weight of 189.32 g/mol. Its IUPAC name is S-propan-2-yl N-(3-methylbutyl)carbamothioate.
Molecular Properties
| Compound Name | S-propan-2-yl N-(3-methylbutyl)carbamothioate |
| PubChem CID | 121263423 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | S-propan-2-yl N-(3-methylbutyl)carbamothioate |
| SMILES | CC(C)CCNC(=O)SC(C)C |
| InChI | InChI=1S/C9H19NOS/c1-7(2)5-6-10-9(11)12-8(3)4/h7-8H,5-6H2,1-4H3,(H,10,11) |
| InChIKey | YXZHXSGKPRXAEN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl N-(3-methylbutyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl N-(3-methylbutyl)carbamothioate?
The IUPAC name of S-propan-2-yl N-(3-methylbutyl)carbamothioate (CID 121263423) is S-propan-2-yl N-(3-methylbutyl)carbamothioate.
What is the SMILES notation for S-propan-2-yl N-(3-methylbutyl)carbamothioate?
The canonical SMILES for S-propan-2-yl N-(3-methylbutyl)carbamothioate is CC(C)CCNC(=O)SC(C)C.
What is the InChIKey of S-propan-2-yl N-(3-methylbutyl)carbamothioate?
The InChIKey is YXZHXSGKPRXAEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NOS/c1-7(2)5-6-10-9(11)12-8(3)4/h7-8H,5-6H2,1-4H3,(H,10,11).
What are the key properties of S-propan-2-yl N-(3-methylbutyl)carbamothioate?
S-propan-2-yl N-(3-methylbutyl)carbamothioate has a molecular weight of 189.32 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl N-(3-methylbutyl)carbamothioate is sourced from PubChem (CID 121263423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).