C18H26N2 — CID 167384299
(E)-N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]prop-1-ene-1,3-diamine (PubChem CID 167384299) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (E)-N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]prop-1-ene-1,3-diamine.
| Compound Name | (E)-N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167384299 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (E)-N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-[(3E,5E)-7-methylocta-1,3,5-trien-3-yl]prop-1-ene-1,3-diamine |
| SMILES | C=C/C=C(\C=C)NC/C=C/N/C(C=C)=C/C=C/C(C)C |
| InChI | InChI=1S/C18H26N2/c1-6-11-17(7-2)19-14-10-15-20-18(8-3)13-9-12-16(4)5/h6-13,15-16,19-20H,1-3,14H2,4-5H3/b12-9+,15-10+,17-11+,18-13+ |
| InChIKey | MVWRWYMTYRRLJM-TWLPZXLQSA-N |
| XLogP | 4.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|