About 3-oxohexan-2-yl thiohypofluorite
3-oxohexan-2-yl thiohypofluorite (PubChem CID 155274985) has the molecular formula C6H11FOS
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-oxohexan-2-yl thiohypofluorite.
Molecular Properties
| Compound Name | 3-oxohexan-2-yl thiohypofluorite |
| PubChem CID | 155274985 |
| Molecular Formula | C6H11FOS |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 3-oxohexan-2-yl thiohypofluorite |
| SMILES | CCCC(=O)C(C)SF |
| InChI | InChI=1S/C6H11FOS/c1-3-4-6(8)5(2)9-7/h5H,3-4H2,1-2H3 |
| InChIKey | IEQDNMXYSJPGJG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-oxohexan-2-yl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohexan-2-yl thiohypofluorite?
The IUPAC name of 3-oxohexan-2-yl thiohypofluorite (CID 155274985) is 3-oxohexan-2-yl thiohypofluorite.
What is the SMILES notation for 3-oxohexan-2-yl thiohypofluorite?
The canonical SMILES for 3-oxohexan-2-yl thiohypofluorite is CCCC(=O)C(C)SF.
What is the InChIKey of 3-oxohexan-2-yl thiohypofluorite?
The InChIKey is IEQDNMXYSJPGJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FOS/c1-3-4-6(8)5(2)9-7/h5H,3-4H2,1-2H3.
What are the key properties of 3-oxohexan-2-yl thiohypofluorite?
3-oxohexan-2-yl thiohypofluorite has a molecular weight of 150.22 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohexan-2-yl thiohypofluorite is sourced from PubChem (CID 155274985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).