C37H54O9 — CID 134475038
4-[4-(3-carboxypropanoyloxy)-3-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenoxy]-4-oxobutanoic acid (PubChem CID 134475038) has the molecular formula C37H54O9 and a molecular weight of 642.83 g/mol. Its IUPAC name is 4-[4-(3-carboxypropanoyloxy)-3-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[4-(3-carboxypropanoyloxy)-3-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134475038 |
| Molecular Formula | C37H54O9 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | 4-[4-(3-carboxypropanoyloxy)-3-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenoxy]-4-oxobutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@](C)(O)CCc1c(C)c(OC(=O)CCC(=O)O)c(C)c(C)c1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C37H54O9/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-22-37(8,44)23-21-30-29(7)35(45-33(42)19-17-31(38)39)27(5)28(6)36(30)46-34(43)20-18-32(40)41/h12,14,16,44H,9-11,13,15,17-23H2,1-8H3,(H,38,39)(H,40,41)/b25-14+,26-16+/t37-/m1/s1 |
| InChIKey | LPMCBHIOSBBWFB-BOFNJHQQSA-N |
| XLogP | 8.04 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|