C39H62O5 — CID 146478351
[4-(2,2-dimethylpropanoyloxy)-3-[(6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenyl] 2,2-dimethylpropanoate (PubChem CID 146478351) has the molecular formula C39H62O5 and a molecular weight of 610.92 g/mol. Its IUPAC name is [4-(2,2-dimethylpropanoyloxy)-3-[(6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(2,2-dimethylpropanoyloxy)-3-[(6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146478351 |
| Molecular Formula | C39H62O5 |
| Molecular Weight | 610.92 g/mol |
| Exact Mass | 610.46 |
| IUPAC Name | [4-(2,2-dimethylpropanoyloxy)-3-[(6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-2,5,6-trimethylphenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC(C)(O)CCc1c(C)c(OC(=O)C(C)(C)C)c(C)c(C)c1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C39H62O5/c1-26(2)18-15-19-27(3)20-16-21-28(4)22-17-24-39(14,42)25-23-32-31(7)33(43-35(40)37(8,9)10)29(5)30(6)34(32)44-36(41)38(11,12)13/h18,20,22,42H,15-17,19,21,23-25H2,1-14H3/b27-20+,28-22+ |
| InChIKey | KBQKULBOAFPVGB-YVKFHLKJSA-N |
| XLogP | 10.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.92 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|