C30H44O4S2 — CID 54308099
4-[2,6-dimethyl-4-[2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid (PubChem CID 54308099) has the molecular formula C30H44O4S2 and a molecular weight of 532.81 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-[2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2,6-dimethyl-4-[2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54308099 |
| Molecular Formula | C30H44O4S2 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 4-[2,6-dimethyl-4-[2-(3,7,11-trimethyldodeca-2,6,10-trienylsulfanyl)propan-2-ylsulfanyl]phenoxy]-4-oxobutanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCSC(C)(C)Sc1cc(C)c(OC(=O)CCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C30H44O4S2/c1-21(2)11-9-12-22(3)13-10-14-23(4)17-18-35-30(7,8)36-26-19-24(5)29(25(6)20-26)34-28(33)16-15-27(31)32/h11,13,17,19-20H,9-10,12,14-16,18H2,1-8H3,(H,31,32) |
| InChIKey | SIYLIAOKHARLNR-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|