C38H63NO4S2 — CID 89400206
2-[ethoxycarbonyl-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 89400206) has the molecular formula C38H63NO4S2 and a molecular weight of 662.06 g/mol. Its IUPAC name is 2-[ethoxycarbonyl-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 2-[ethoxycarbonyl-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 89400206 |
| Molecular Formula | C38H63NO4S2 |
| Molecular Weight | 662.06 g/mol |
| Exact Mass | 661.42 |
| IUPAC Name | 2-[ethoxycarbonyl-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethyl]amino]-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CCOC(=O)N(CCSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)(SC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C38H63NO4S2/c1-11-43-37(42)39(26-29-44-27-24-34(8)22-14-20-32(6)18-12-16-30(2)3)38(10,36(40)41)45-28-25-35(9)23-15-21-33(7)19-13-17-31(4)5/h16-17,20-21,24-25H,11-15,18-19,22-23,26-29H2,1-10H3,(H,40,41)/b32-20+,33-21+,34-24+,35-25+ |
| InChIKey | DBKHCTNCZLKCTB-KHUAHTNFSA-N |
| XLogP | 11.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.06 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|