C16H21ClO4 — CID 10903069
methyl 5-chloro-2,4-dimethoxy-6-methyl-3-(3-methylbut-2-enyl)benzoate (PubChem CID 10903069) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is methyl 5-chloro-2,4-dimethoxy-6-methyl-3-(3-methylbut-2-enyl)benzoate.
| Compound Name | methyl 5-chloro-2,4-dimethoxy-6-methyl-3-(3-methylbut-2-enyl)benzoate |
|---|---|
| PubChem CID | 10903069 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 5-chloro-2,4-dimethoxy-6-methyl-3-(3-methylbut-2-enyl)benzoate |
| SMILES | COC(=O)c1c(C)c(Cl)c(OC)c(CC=C(C)C)c1OC |
| InChI | InChI=1S/C16H21ClO4/c1-9(2)7-8-11-14(19-4)12(16(18)21-6)10(3)13(17)15(11)20-5/h7H,8H2,1-6H3 |
| InChIKey | DZFRHVUZXUEQKO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|