C27H34O4 — CID 127031427
methyl 2-hydroxy-4-methoxy-3,5-bis(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate (PubChem CID 127031427) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 2-hydroxy-4-methoxy-3,5-bis(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate.
| Compound Name | methyl 2-hydroxy-4-methoxy-3,5-bis(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate |
|---|---|
| PubChem CID | 127031427 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl 2-hydroxy-4-methoxy-3,5-bis(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate |
| SMILES | COC(=O)c1c(O)c(CC=C(C)C)c(OC)c(CC=C(C)C)c1CCc1ccccc1 |
| InChI | InChI=1S/C27H34O4/c1-18(2)12-15-22-21(17-14-20-10-8-7-9-11-20)24(27(29)31-6)25(28)23(26(22)30-5)16-13-19(3)4/h7-13,28H,14-17H2,1-6H3 |
| InChIKey | RAZZBDOCOMIWEM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|