C28H36O4 — CID 71680962
ethyl 4-methoxy-2-(3-methylbut-2-enoxy)-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate (PubChem CID 71680962) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is ethyl 4-methoxy-2-(3-methylbut-2-enoxy)-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate.
| Compound Name | ethyl 4-methoxy-2-(3-methylbut-2-enoxy)-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate |
|---|---|
| PubChem CID | 71680962 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | ethyl 4-methoxy-2-(3-methylbut-2-enoxy)-3-(3-methylbut-2-enyl)-6-(2-phenylethyl)benzoate |
| SMILES | CCOC(=O)c1c(CCc2ccccc2)cc(OC)c(CC=C(C)C)c1OCC=C(C)C |
| InChI | InChI=1S/C28H36O4/c1-7-31-28(29)26-23(15-14-22-11-9-8-10-12-22)19-25(30-6)24(16-13-20(2)3)27(26)32-18-17-21(4)5/h8-13,17,19H,7,14-16,18H2,1-6H3 |
| InChIKey | ZAZWDVJVGLGRGA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|