C31H34O4 — CID 71626259
methyl 6-[(E)-1,4-diphenylpent-1-en-3-yl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate (PubChem CID 71626259) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is methyl 6-[(E)-1,4-diphenylpent-1-en-3-yl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate.
| Compound Name | methyl 6-[(E)-1,4-diphenylpent-1-en-3-yl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate |
|---|---|
| PubChem CID | 71626259 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | methyl 6-[(E)-1,4-diphenylpent-1-en-3-yl]-2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)benzoate |
| SMILES | COC(=O)c1c(C(/C=C/c2ccccc2)C(C)c2ccccc2)cc(OC)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C31H34O4/c1-21(2)16-18-26-28(34-4)20-27(29(30(26)32)31(33)35-5)25(19-17-23-12-8-6-9-13-23)22(3)24-14-10-7-11-15-24/h6-17,19-20,22,25,32H,18H2,1-5H3/b19-17+ |
| InChIKey | IVRRZMQJAGQZPA-HTXNQAPBSA-N |
| XLogP | 7.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|