C28H28O4 — CID 86344236
methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-(4-phenylphenyl)ethenyl]benzoate (PubChem CID 86344236) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-(4-phenylphenyl)ethenyl]benzoate.
| Compound Name | methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-(4-phenylphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 86344236 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | methyl 2-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-6-[(E)-2-(4-phenylphenyl)ethenyl]benzoate |
| SMILES | COC(=O)c1c(/C=C/c2ccc(-c3ccccc3)cc2)cc(OC)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C28H28O4/c1-19(2)10-17-24-25(31-3)18-23(26(27(24)29)28(30)32-4)16-13-20-11-14-22(15-12-20)21-8-6-5-7-9-21/h5-16,18,29H,17H2,1-4H3/b16-13+ |
| InChIKey | HECKTTOYHHVADY-DTQAZKPQSA-N |
| XLogP | 6.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|