C26H26F6O4 — CID 163207576
methyl 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate (PubChem CID 163207576) has the molecular formula C26H26F6O4 and a molecular weight of 516.48 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 163207576 |
| Molecular Formula | C26H26F6O4 |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | methyl 2-hydroxy-3-(3-methylbut-2-enyl)-4-(4,4,4-trifluorobutoxy)-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1c(/C=C/c2ccc(C(F)(F)F)cc2)cc(OCCCC(F)(F)F)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C26H26F6O4/c1-16(2)5-12-20-21(36-14-4-13-25(27,28)29)15-18(22(23(20)33)24(34)35-3)9-6-17-7-10-19(11-8-17)26(30,31)32/h5-11,15,33H,4,12-14H2,1-3H3/b9-6+ |
| InChIKey | GMVCCCCYGLVHED-RMKNXTFCSA-N |
| XLogP | 7.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|