C22H22F2O4 — CID 175207108
4-(2-fluoroethoxy)-6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid (PubChem CID 175207108) has the molecular formula C22H22F2O4 and a molecular weight of 388.41 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid.
| Compound Name | 4-(2-fluoroethoxy)-6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid |
|---|---|
| PubChem CID | 175207108 |
| Molecular Formula | C22H22F2O4 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(2-fluoroethoxy)-6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid |
| SMILES | CC(C)=CCc1c(OCCF)cc(C=Cc2ccc(F)cc2)c(C(=O)O)c1O |
| InChI | InChI=1S/C22H22F2O4/c1-14(2)3-10-18-19(28-12-11-23)13-16(20(21(18)25)22(26)27)7-4-15-5-8-17(24)9-6-15/h3-9,13,25H,10-12H2,1-2H3,(H,26,27) |
| InChIKey | OEHBCMLPMKOZFX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|