C18H16F2O4 — CID 175426387
4-(2-fluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxy-3-methylbenzoic acid (PubChem CID 175426387) has the molecular formula C18H16F2O4 and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxy-3-methylbenzoic acid.
| Compound Name | 4-(2-fluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 175426387 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(2-fluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxy-3-methylbenzoic acid |
| SMILES | Cc1c(OCCF)cc(O)c(C(=O)O)c1C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F2O4/c1-11-14(7-4-12-2-5-13(20)6-3-12)17(18(22)23)15(21)10-16(11)24-9-8-19/h2-7,10,21H,8-9H2,1H3,(H,22,23) |
| InChIKey | YGXYATVEXXZATR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|