C17H13F3O4 — CID 175696041
4-(2,2-difluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxybenzoic acid (PubChem CID 175696041) has the molecular formula C17H13F3O4 and a molecular weight of 338.28 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxybenzoic acid.
| Compound Name | 4-(2,2-difluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 175696041 |
| Molecular Formula | C17H13F3O4 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-2-[2-(4-fluorophenyl)ethenyl]-6-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)cc(OCC(F)F)cc1C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F3O4/c18-12-5-2-10(3-6-12)1-4-11-7-13(24-9-15(19)20)8-14(21)16(11)17(22)23/h1-8,15,21H,9H2,(H,22,23) |
| InChIKey | VIAMCLJYDQISEK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|