C16H13FO4 — CID 122183158
2-[(E)-2-(3-fluorophenyl)ethenyl]-6-hydroxy-4-methoxybenzoic acid (PubChem CID 122183158) has the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-[(E)-2-(3-fluorophenyl)ethenyl]-6-hydroxy-4-methoxybenzoic acid.
| Compound Name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-6-hydroxy-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 122183158 |
| Molecular Formula | C16H13FO4 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-6-hydroxy-4-methoxybenzoic acid |
| SMILES | COc1cc(O)c(C(=O)O)c(/C=C/c2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H13FO4/c1-21-13-8-11(15(16(19)20)14(18)9-13)6-5-10-3-2-4-12(17)7-10/h2-9,18H,1H3,(H,19,20)/b6-5+ |
| InChIKey | QMJVZTQXRXTWRO-AATRIKPKSA-N |
| XLogP | 3.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|