C20H16F6O4 — CID 175426375
methyl 2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]-4-(1,2,3-trifluoropropoxy)benzoate (PubChem CID 175426375) has the molecular formula C20H16F6O4 and a molecular weight of 434.33 g/mol. Its IUPAC name is methyl 2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]-4-(1,2,3-trifluoropropoxy)benzoate.
| Compound Name | methyl 2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]-4-(1,2,3-trifluoropropoxy)benzoate |
|---|---|
| PubChem CID | 175426375 |
| Molecular Formula | C20H16F6O4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | methyl 2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]-4-(1,2,3-trifluoropropoxy)benzoate |
| SMILES | COC(=O)c1c(O)cc(OC(F)C(F)CF)cc1C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F6O4/c1-29-19(28)17-12(5-2-11-3-6-13(7-4-11)20(24,25)26)8-14(9-16(17)27)30-18(23)15(22)10-21/h2-9,15,18,27H,10H2,1H3 |
| InChIKey | HKDHPHJFJYJHAL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|