C21H19F3O4 — CID 175426321
methyl 4-cyclobutyloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate (PubChem CID 175426321) has the molecular formula C21H19F3O4 and a molecular weight of 392.37 g/mol. Its IUPAC name is methyl 4-cyclobutyloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-cyclobutyloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 175426321 |
| Molecular Formula | C21H19F3O4 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | methyl 4-cyclobutyloxy-2-hydroxy-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1c(O)cc(OC2CCC2)cc1C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3O4/c1-27-20(26)19-14(11-17(12-18(19)25)28-16-3-2-4-16)8-5-13-6-9-15(10-7-13)21(22,23)24/h5-12,16,25H,2-4H2,1H3 |
| InChIKey | ODUSXAVKQZCNGB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|