C23H22F4O4 — CID 175202274
4-(2-fluoroethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid (PubChem CID 175202274) has the molecular formula C23H22F4O4 and a molecular weight of 438.42 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid.
| Compound Name | 4-(2-fluoroethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 175202274 |
| Molecular Formula | C23H22F4O4 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 4-(2-fluoroethoxy)-2-hydroxy-3-(3-methylbut-2-enyl)-6-[2-[4-(trifluoromethyl)phenyl]ethenyl]benzoic acid |
| SMILES | CC(C)=CCc1c(OCCF)cc(C=Cc2ccc(C(F)(F)F)cc2)c(C(=O)O)c1O |
| InChI | InChI=1S/C23H22F4O4/c1-14(2)3-10-18-19(31-12-11-24)13-16(20(21(18)28)22(29)30)7-4-15-5-8-17(9-6-15)23(25,26)27/h3-9,13,28H,10-12H2,1-2H3,(H,29,30) |
| InChIKey | IJZYNKHSBVFEBI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|