C25H27FO5 — CID 175426397
6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)-4-(oxan-4-yloxy)benzoic acid (PubChem CID 175426397) has the molecular formula C25H27FO5 and a molecular weight of 426.48 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)-4-(oxan-4-yloxy)benzoic acid.
| Compound Name | 6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)-4-(oxan-4-yloxy)benzoic acid |
|---|---|
| PubChem CID | 175426397 |
| Molecular Formula | C25H27FO5 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 6-[2-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)-4-(oxan-4-yloxy)benzoic acid |
| SMILES | CC(C)=CCc1c(OC2CCOCC2)cc(C=Cc2ccc(F)cc2)c(C(=O)O)c1O |
| InChI | InChI=1S/C25H27FO5/c1-16(2)3-10-21-22(31-20-11-13-30-14-12-20)15-18(23(24(21)27)25(28)29)7-4-17-5-8-19(26)9-6-17/h3-9,15,20,27H,10-14H2,1-2H3,(H,28,29) |
| InChIKey | SKIJWXJEVLTLIR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|