C26H29FO4 — CID 175207103
4-cyclohexyloxy-6-[1-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid (PubChem CID 175207103) has the molecular formula C26H29FO4 and a molecular weight of 424.51 g/mol. Its IUPAC name is 4-cyclohexyloxy-6-[1-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid.
| Compound Name | 4-cyclohexyloxy-6-[1-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid |
|---|---|
| PubChem CID | 175207103 |
| Molecular Formula | C26H29FO4 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-cyclohexyloxy-6-[1-(4-fluorophenyl)ethenyl]-2-hydroxy-3-(3-methylbut-2-enyl)benzoic acid |
| SMILES | C=C(c1ccc(F)cc1)c1cc(OC2CCCCC2)c(CC=C(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C26H29FO4/c1-16(2)9-14-21-23(31-20-7-5-4-6-8-20)15-22(24(25(21)28)26(29)30)17(3)18-10-12-19(27)13-11-18/h9-13,15,20,28H,3-8,14H2,1-2H3,(H,29,30) |
| InChIKey | SNSIKAZNXWJRPR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|