C22H27FN2O2S — CID 87331455
S-ethyl N-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]carbamothioate (PubChem CID 87331455) has the molecular formula C22H27FN2O2S and a molecular weight of 402.54 g/mol. Its IUPAC name is S-ethyl N-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]carbamothioate.
| Compound Name | S-ethyl N-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]carbamothioate |
|---|---|
| PubChem CID | 87331455 |
| Molecular Formula | C22H27FN2O2S |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | S-ethyl N-[2-cyclopentyloxy-4-[(4-fluorophenyl)methyl-methylamino]phenyl]carbamothioate |
| SMILES | CCSC(=O)Nc1ccc(N(C)Cc2ccc(F)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C22H27FN2O2S/c1-3-28-22(26)24-20-13-12-18(14-21(20)27-19-6-4-5-7-19)25(2)15-16-8-10-17(23)11-9-16/h8-14,19H,3-7,15H2,1-2H3,(H,24,26) |
| InChIKey | QXUAYTHTYPXRJX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|