C22H22Cl2O8 — CID 53254578
dimethyl 4,8-dichloro-2,3,6,7-tetramethoxy-9,10-dihydroanthracene-1,5-dicarboxylate (PubChem CID 53254578) has the molecular formula C22H22Cl2O8 and a molecular weight of 485.32 g/mol. Its IUPAC name is dimethyl 4,8-dichloro-2,3,6,7-tetramethoxy-9,10-dihydroanthracene-1,5-dicarboxylate.
| Compound Name | dimethyl 4,8-dichloro-2,3,6,7-tetramethoxy-9,10-dihydroanthracene-1,5-dicarboxylate |
|---|---|
| PubChem CID | 53254578 |
| Molecular Formula | C22H22Cl2O8 |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | dimethyl 4,8-dichloro-2,3,6,7-tetramethoxy-9,10-dihydroanthracene-1,5-dicarboxylate |
| SMILES | COC(=O)c1c2c(c(Cl)c(OC)c1OC)Cc1c(c(Cl)c(OC)c(OC)c1C(=O)OC)C2 |
| InChI | InChI=1S/C22H22Cl2O8/c1-27-17-13(21(25)31-5)9-7-12-10(8-11(9)15(23)19(17)29-3)14(22(26)32-6)18(28-2)20(30-4)16(12)24/h7-8H2,1-6H3 |
| InChIKey | PDFRPSCUPIFIED-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |