C24H26O8 — CID 162842870
2,4,9-trihydroxy-5,6-dimethoxy-7-methyl-8-(3-methylbut-2-enyl)-2-(2-oxopropyl)phenalene-1,3-dione (PubChem CID 162842870) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is 2,4,9-trihydroxy-5,6-dimethoxy-7-methyl-8-(3-methylbut-2-enyl)-2-(2-oxopropyl)phenalene-1,3-dione.
| Compound Name | 2,4,9-trihydroxy-5,6-dimethoxy-7-methyl-8-(3-methylbut-2-enyl)-2-(2-oxopropyl)phenalene-1,3-dione |
|---|---|
| PubChem CID | 162842870 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2,4,9-trihydroxy-5,6-dimethoxy-7-methyl-8-(3-methylbut-2-enyl)-2-(2-oxopropyl)phenalene-1,3-dione |
| SMILES | COc1c(O)c2c3c(c(O)c(CC=C(C)C)c(C)c3c1OC)C(=O)C(O)(CC(C)=O)C2=O |
| InChI | InChI=1S/C24H26O8/c1-10(2)7-8-13-12(4)14-15-16(18(13)26)22(28)24(30,9-11(3)25)23(29)17(15)19(27)21(32-6)20(14)31-5/h7,26-27,30H,8-9H2,1-6H3 |
| InChIKey | PYRBNXCKHYFKKU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|