C25H30O2 — CID 57413642
1-methoxy-5-(3-methylbut-2-enoxy)-2-(3-methylbut-2-enyl)-3-[(E)-2-phenylethenyl]benzene (PubChem CID 57413642) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-methoxy-5-(3-methylbut-2-enoxy)-2-(3-methylbut-2-enyl)-3-[(E)-2-phenylethenyl]benzene.
| Compound Name | 1-methoxy-5-(3-methylbut-2-enoxy)-2-(3-methylbut-2-enyl)-3-[(E)-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 57413642 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-methoxy-5-(3-methylbut-2-enoxy)-2-(3-methylbut-2-enyl)-3-[(E)-2-phenylethenyl]benzene |
| SMILES | COc1cc(OCC=C(C)C)cc(/C=C/c2ccccc2)c1CC=C(C)C |
| InChI | InChI=1S/C25H30O2/c1-19(2)11-14-24-22(13-12-21-9-7-6-8-10-21)17-23(18-25(24)26-5)27-16-15-20(3)4/h6-13,15,17-18H,14,16H2,1-5H3/b13-12+ |
| InChIKey | VPGQFHRLBQIVKN-OUKQBFOZSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|