C32H49NO7Si2 — CID 166173162
2-[[3-methoxy-4-(3-methylbut-2-enyl)-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 166173162) has the molecular formula C32H49NO7Si2 and a molecular weight of 615.92 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(3-methylbut-2-enyl)-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-methoxy-4-(3-methylbut-2-enyl)-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 166173162 |
| Molecular Formula | C32H49NO7Si2 |
| Molecular Weight | 615.92 g/mol |
| Exact Mass | 615.30 |
| IUPAC Name | 2-[[3-methoxy-4-(3-methylbut-2-enyl)-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(OCOCC[Si](C)(C)C)cc(/C=C/c2ccc(OCOCC[Si](C)(C)C)c([N+](=O)[O-])c2)c1CC=C(C)C |
| InChI | InChI=1S/C32H49NO7Si2/c1-25(2)10-14-29-27(21-28(22-32(29)36-3)39-23-37-16-18-41(4,5)6)13-11-26-12-15-31(30(20-26)33(34)35)40-24-38-17-19-42(7,8)9/h10-13,15,20-22H,14,16-19,23-24H2,1-9H3/b13-11+ |
| InChIKey | PIQNFJWCLSPNNN-ACCUITESSA-N |
| XLogP | 8.66 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.92 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|