C22H28BrNO5Si — CID 174070177
2-[[4-bromo-3-[(E)-2-(3-methoxy-4-nitrophenyl)ethenyl]-5-methylphenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 174070177) has the molecular formula C22H28BrNO5Si and a molecular weight of 494.46 g/mol. Its IUPAC name is 2-[[4-bromo-3-[(E)-2-(3-methoxy-4-nitrophenyl)ethenyl]-5-methylphenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-bromo-3-[(E)-2-(3-methoxy-4-nitrophenyl)ethenyl]-5-methylphenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174070177 |
| Molecular Formula | C22H28BrNO5Si |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 2-[[4-bromo-3-[(E)-2-(3-methoxy-4-nitrophenyl)ethenyl]-5-methylphenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(/C=C/c2cc(OCOCC[Si](C)(C)C)cc(C)c2Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28BrNO5Si/c1-16-12-19(29-15-28-10-11-30(3,4)5)14-18(22(16)23)8-6-17-7-9-20(24(25)26)21(13-17)27-2/h6-9,12-14H,10-11,15H2,1-5H3/b8-6+ |
| InChIKey | OUEQREJPCCVCOM-SOFGYWHQSA-N |
| XLogP | 6.54 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|