C27H40BrNO7Si2 — CID 166173173
2-[[4-bromo-3-methoxy-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 166173173) has the molecular formula C27H40BrNO7Si2 and a molecular weight of 626.69 g/mol. Its IUPAC name is 2-[[4-bromo-3-methoxy-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-bromo-3-methoxy-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 166173173 |
| Molecular Formula | C27H40BrNO7Si2 |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | 2-[[4-bromo-3-methoxy-5-[(E)-2-[3-nitro-4-(2-trimethylsilylethoxymethoxy)phenyl]ethenyl]phenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(OCOCC[Si](C)(C)C)cc(/C=C/c2ccc(OCOCC[Si](C)(C)C)c([N+](=O)[O-])c2)c1Br |
| InChI | InChI=1S/C27H40BrNO7Si2/c1-32-26-18-23(35-19-33-12-14-37(2,3)4)17-22(27(26)28)10-8-21-9-11-25(24(16-21)29(30)31)36-20-34-13-15-38(5,6)7/h8-11,16-18H,12-15,19-20H2,1-7H3/b10-8+ |
| InChIKey | QGUWZZKNVPHFEP-CSKARUKUSA-N |
| XLogP | 7.92 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|