C19H21BrF3NO6Si — CID 176899878
2-[[2-bromo-5-nitro-4-[3-(trifluoromethoxy)phenoxy]phenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 176899878) has the molecular formula C19H21BrF3NO6Si and a molecular weight of 524.36 g/mol. Its IUPAC name is 2-[[2-bromo-5-nitro-4-[3-(trifluoromethoxy)phenoxy]phenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-bromo-5-nitro-4-[3-(trifluoromethoxy)phenoxy]phenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 176899878 |
| Molecular Formula | C19H21BrF3NO6Si |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | 2-[[2-bromo-5-nitro-4-[3-(trifluoromethoxy)phenoxy]phenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCOc1cc([N+](=O)[O-])c(Oc2cccc(OC(F)(F)F)c2)cc1Br |
| InChI | InChI=1S/C19H21BrF3NO6Si/c1-31(2,3)8-7-27-12-28-17-11-16(24(25)26)18(10-15(17)20)29-13-5-4-6-14(9-13)30-19(21,22)23/h4-6,9-11H,7-8,12H2,1-3H3 |
| InChIKey | CEGWTCFSQULSPE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|