C25H31NO8 — CID 68976724
1,3-bis(methoxymethoxy)-5-[(E)-2-[4-(methoxymethoxy)-3-nitrophenyl]ethenyl]-2-(3-methylbut-2-enyl)benzene (PubChem CID 68976724) has the molecular formula C25H31NO8 and a molecular weight of 473.52 g/mol. Its IUPAC name is 1,3-bis(methoxymethoxy)-5-[(E)-2-[4-(methoxymethoxy)-3-nitrophenyl]ethenyl]-2-(3-methylbut-2-enyl)benzene.
| Compound Name | 1,3-bis(methoxymethoxy)-5-[(E)-2-[4-(methoxymethoxy)-3-nitrophenyl]ethenyl]-2-(3-methylbut-2-enyl)benzene |
|---|---|
| PubChem CID | 68976724 |
| Molecular Formula | C25H31NO8 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1,3-bis(methoxymethoxy)-5-[(E)-2-[4-(methoxymethoxy)-3-nitrophenyl]ethenyl]-2-(3-methylbut-2-enyl)benzene |
| SMILES | COCOc1ccc(/C=C/c2cc(OCOC)c(CC=C(C)C)c(OCOC)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H31NO8/c1-18(2)6-10-21-24(33-16-30-4)13-20(14-25(21)34-17-31-5)8-7-19-9-11-23(32-15-29-3)22(12-19)26(27)28/h6-9,11-14H,10,15-17H2,1-5H3/b8-7+ |
| InChIKey | FFVNEJZRAQTIHW-BQYQJAHWSA-N |
| XLogP | 5.22 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|