C19H22O3 — CID 141105081
1-[2-hydroxy-4-methoxy-3-(3-methylbuta-1,3-dienyl)phenyl]-5-methylhexa-2,4-dien-1-one (PubChem CID 141105081) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[2-hydroxy-4-methoxy-3-(3-methylbuta-1,3-dienyl)phenyl]-5-methylhexa-2,4-dien-1-one.
| Compound Name | 1-[2-hydroxy-4-methoxy-3-(3-methylbuta-1,3-dienyl)phenyl]-5-methylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141105081 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-[2-hydroxy-4-methoxy-3-(3-methylbuta-1,3-dienyl)phenyl]-5-methylhexa-2,4-dien-1-one |
| SMILES | C=C(C)C=Cc1c(OC)ccc(C(=O)C=CC=C(C)C)c1O |
| InChI | InChI=1S/C19H22O3/c1-13(2)7-6-8-17(20)15-11-12-18(22-5)16(19(15)21)10-9-14(3)4/h6-12,21H,3H2,1-2,4-5H3 |
| InChIKey | NAJGGGBLRQQVJM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|