C28H26O4 — CID 141105070
3-(4-hydroxyphenyl)-1-[4-methoxy-3-(3-methylbuta-1,3-dienyl)-2-phenylmethoxyphenyl]prop-2-en-1-one (PubChem CID 141105070) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1-[4-methoxy-3-(3-methylbuta-1,3-dienyl)-2-phenylmethoxyphenyl]prop-2-en-1-one.
| Compound Name | 3-(4-hydroxyphenyl)-1-[4-methoxy-3-(3-methylbuta-1,3-dienyl)-2-phenylmethoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 141105070 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1-[4-methoxy-3-(3-methylbuta-1,3-dienyl)-2-phenylmethoxyphenyl]prop-2-en-1-one |
| SMILES | C=C(C)C=Cc1c(OC)ccc(C(=O)C=Cc2ccc(O)cc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H26O4/c1-20(2)9-15-25-27(31-3)18-16-24(28(25)32-19-22-7-5-4-6-8-22)26(30)17-12-21-10-13-23(29)14-11-21/h4-18,29H,1,19H2,2-3H3 |
| InChIKey | JOBMWONDRNORTC-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|