C18H22O4 — CID 73212224
5,7,8-trimethoxy-6-(3-methylbut-2-enyl)naphthalen-1-ol (PubChem CID 73212224) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 5,7,8-trimethoxy-6-(3-methylbut-2-enyl)naphthalen-1-ol.
| Compound Name | 5,7,8-trimethoxy-6-(3-methylbut-2-enyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 73212224 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5,7,8-trimethoxy-6-(3-methylbut-2-enyl)naphthalen-1-ol |
| SMILES | COc1c(CC=C(C)C)c(OC)c2cccc(O)c2c1OC |
| InChI | InChI=1S/C18H22O4/c1-11(2)9-10-13-16(20-3)12-7-6-8-14(19)15(12)18(22-5)17(13)21-4/h6-9,19H,10H2,1-5H3 |
| InChIKey | MEPKUQKLCIMXET-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|