C8H8INO2 — CID 130673906
(3R)-3-amino-6-iodo-2,3-dihydro-1-benzofuran-4-ol (PubChem CID 130673906) has the molecular formula C8H8INO2 and a molecular weight of 277.06 g/mol. Its IUPAC name is (3R)-3-amino-6-iodo-2,3-dihydro-1-benzofuran-4-ol.
| Compound Name | (3R)-3-amino-6-iodo-2,3-dihydro-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 130673906 |
| Molecular Formula | C8H8INO2 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | (3R)-3-amino-6-iodo-2,3-dihydro-1-benzofuran-4-ol |
| SMILES | N[C@H]1COc2cc(I)cc(O)c21 |
| InChI | InChI=1S/C8H8INO2/c9-4-1-6(11)8-5(10)3-12-7(8)2-4/h1-2,5,11H,3,10H2/t5-/m0/s1 |
| InChIKey | OEUKBAZBQPTMGX-YFKPBYRVSA-N |
| XLogP | 1.39 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|