C10H12INO2 — CID 130054134
6-ethoxy-4-iodo-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130054134) has the molecular formula C10H12INO2 and a molecular weight of 305.12 g/mol. Its IUPAC name is 6-ethoxy-4-iodo-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 6-ethoxy-4-iodo-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130054134 |
| Molecular Formula | C10H12INO2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 6-ethoxy-4-iodo-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCOc1cc(I)c2c(c1)OCC2N |
| InChI | InChI=1S/C10H12INO2/c1-2-13-6-3-7(11)10-8(12)5-14-9(10)4-6/h3-4,8H,2,5,12H2,1H3 |
| InChIKey | UZFLUZXFMONOEJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|