C11H12N2O — CID 130053828
3-amino-4-ethyl-2,3-dihydro-1-benzofuran-6-carbonitrile (PubChem CID 130053828) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-amino-4-ethyl-2,3-dihydro-1-benzofuran-6-carbonitrile.
| Compound Name | 3-amino-4-ethyl-2,3-dihydro-1-benzofuran-6-carbonitrile |
|---|---|
| PubChem CID | 130053828 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-amino-4-ethyl-2,3-dihydro-1-benzofuran-6-carbonitrile |
| SMILES | CCc1cc(C#N)cc2c1C(N)CO2 |
| InChI | InChI=1S/C11H12N2O/c1-2-8-3-7(5-12)4-10-11(8)9(13)6-14-10/h3-4,9H,2,6,13H2,1H3 |
| InChIKey | AIXYJVFXCTYCFD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |