C10H14N2O — CID 130643053
(3R)-4-ethyl-2,3-dihydro-1-benzofuran-3,7-diamine (PubChem CID 130643053) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (3R)-4-ethyl-2,3-dihydro-1-benzofuran-3,7-diamine.
| Compound Name | (3R)-4-ethyl-2,3-dihydro-1-benzofuran-3,7-diamine |
|---|---|
| PubChem CID | 130643053 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (3R)-4-ethyl-2,3-dihydro-1-benzofuran-3,7-diamine |
| SMILES | CCc1ccc(N)c2c1[C@@H](N)CO2 |
| InChI | InChI=1S/C10H14N2O/c1-2-6-3-4-7(11)10-9(6)8(12)5-13-10/h3-4,8H,2,5,11-12H2,1H3/t8-/m0/s1 |
| InChIKey | DWKIBSJIYAMJJV-QMMMGPOBSA-N |
| XLogP | 1.22 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|