C10H12BrNO — CID 130741328
(3R)-7-bromo-4-ethyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130741328) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is (3R)-7-bromo-4-ethyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3R)-7-bromo-4-ethyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130741328 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | (3R)-7-bromo-4-ethyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCc1ccc(Br)c2c1[C@@H](N)CO2 |
| InChI | InChI=1S/C10H12BrNO/c1-2-6-3-4-7(11)10-9(6)8(12)5-13-10/h3-4,8H,2,5,12H2,1H3/t8-/m0/s1 |
| InChIKey | MLSYDUWSJHCQDJ-QMMMGPOBSA-N |
| XLogP | 2.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |