C12H16BrN — CID 130985321
(1R)-5-bromo-8-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 130985321) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is (1R)-5-bromo-8-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-5-bromo-8-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 130985321 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (1R)-5-bromo-8-ethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CCc1ccc(Br)c2c1[C@H](N)CCC2 |
| InChI | InChI=1S/C12H16BrN/c1-2-8-6-7-10(13)9-4-3-5-11(14)12(8)9/h6-7,11H,2-5,14H2,1H3/t11-/m1/s1 |
| InChIKey | HGNQCOAERKGADO-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |