About (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine
(4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine (PubChem CID 131081672) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine.
Molecular Properties
| Compound Name | (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine |
| PubChem CID | 131081672 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine |
| SMILES | CCc1ccc(N)c2c1OCC[C@H]2N |
| InChI | InChI=1S/C11H16N2O/c1-2-7-3-4-8(12)10-9(13)5-6-14-11(7)10/h3-4,9H,2,5-6,12-13H2,1H3/t9-/m1/s1 |
| InChIKey | FHASXXOLYKCBCK-SECBINFHSA-N |
| XLogP | 1.61 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine?
The IUPAC name of (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine (CID 131081672) is (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine.
What is the SMILES notation for (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine?
The canonical SMILES for (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine is CCc1ccc(N)c2c1OCC[C@H]2N.
What is the InChIKey of (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine?
The InChIKey is FHASXXOLYKCBCK-SECBINFHSA-N. The full InChI is InChI=1S/C11H16N2O/c1-2-7-3-4-8(12)10-9(13)5-6-14-11(7)10/h3-4,9H,2,5-6,12-13H2,1H3/t9-/m1/s1.
What are the key properties of (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine?
(4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine has a molecular weight of 192.26 g/mol, XLogP of 1.61, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine is sourced from PubChem (CID 131081672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).