C11H16N2O — CID 131081672
(4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine (PubChem CID 131081672) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine.
| Compound Name | (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine |
|---|---|
| PubChem CID | 131081672 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (4R)-8-ethyl-3,4-dihydro-2H-chromene-4,5-diamine |
| SMILES | CCc1ccc(N)c2c1OCC[C@H]2N |
| InChI | InChI=1S/C11H16N2O/c1-2-7-3-4-8(12)10-9(13)5-6-14-11(7)10/h3-4,9H,2,5-6,12-13H2,1H3/t9-/m1/s1 |
| InChIKey | FHASXXOLYKCBCK-SECBINFHSA-N |
| XLogP | 1.61 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|