C10H12BrNO2 — CID 130615757
(4S)-8-bromo-5-methoxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 130615757) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is (4S)-8-bromo-5-methoxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-8-bromo-5-methoxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 130615757 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (4S)-8-bromo-5-methoxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc(Br)c2c1[C@@H](N)CCO2 |
| InChI | InChI=1S/C10H12BrNO2/c1-13-8-3-2-6(11)10-9(8)7(12)4-5-14-10/h2-3,7H,4-5,12H2,1H3/t7-/m0/s1 |
| InChIKey | OUAVWBJNUTYYHB-ZETCQYMHSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |