C9H10BrNO — CID 130741516
(3S)-4-bromo-6-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 130741516) has the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. Its IUPAC name is (3S)-4-bromo-6-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3S)-4-bromo-6-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 130741516 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (3S)-4-bromo-6-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | Cc1cc(Br)c2c(c1)OC[C@H]2N |
| InChI | InChI=1S/C9H10BrNO/c1-5-2-6(10)9-7(11)4-12-8(9)3-5/h2-3,7H,4,11H2,1H3/t7-/m1/s1 |
| InChIKey | KNFCSJRTIFOXNG-SSDOTTSWSA-N |
| XLogP | 2.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |