C14H19NO4 — CID 115248282
3-[(4-methoxy-2,5-dimethylanilino)methyl]oxetane-3-carboxylic acid (PubChem CID 115248282) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[(4-methoxy-2,5-dimethylanilino)methyl]oxetane-3-carboxylic acid.
| Compound Name | 3-[(4-methoxy-2,5-dimethylanilino)methyl]oxetane-3-carboxylic acid |
|---|---|
| PubChem CID | 115248282 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[(4-methoxy-2,5-dimethylanilino)methyl]oxetane-3-carboxylic acid |
| SMILES | COc1cc(C)c(NCC2(C(=O)O)COC2)cc1C |
| InChI | InChI=1S/C14H19NO4/c1-9-5-12(18-3)10(2)4-11(9)15-6-14(13(16)17)7-19-8-14/h4-5,15H,6-8H2,1-3H3,(H,16,17) |
| InChIKey | CFHHDIPRCITNLY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|