3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid

C13H16O5 — CID 116930077

IUPAC3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid
SMILESCOc1ccc(OC)c(CC2(C(=O)O)COC2)c1
InChIInChI=1S/C13H16O5/c1-16-10-3-4-11(17-2)9(5-10)6-13(12(14)15)7-18-8-13/h3-5H,6-8H2,1-2H3,(H,14,15)
InChIKeyFPLVJCQONNIZNK-UHFFFAOYSA-N
MW252.27 g/mol
LogP1.35
Rot. Bonds5

About 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid

3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid (PubChem CID 116930077) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid.

Molecular Properties

Compound Name3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid
PubChem CID116930077
Molecular FormulaC13H16O5
Molecular Weight252.27 g/mol
Exact Mass252.10
IUPAC Name3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid
SMILESCOc1ccc(OC)c(CC2(C(=O)O)COC2)c1
InChIInChI=1S/C13H16O5/c1-16-10-3-4-11(17-2)9(5-10)6-13(12(14)15)7-18-8-13/h3-5H,6-8H2,1-2H3,(H,14,15)
InChIKeyFPLVJCQONNIZNK-UHFFFAOYSA-N
XLogP1.35
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.27
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid?
The IUPAC name of 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid (CID 116930077) is 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid.
What is the SMILES notation for 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid?
The canonical SMILES for 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid is COc1ccc(OC)c(CC2(C(=O)O)COC2)c1.
What is the InChIKey of 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid?
The InChIKey is FPLVJCQONNIZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-16-10-3-4-11(17-2)9(5-10)6-13(12(14)15)7-18-8-13/h3-5H,6-8H2,1-2H3,(H,14,15).
What are the key properties of 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid?
3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid has a molecular weight of 252.27 g/mol, XLogP of 1.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dimethoxyphenyl)methyl]oxetane-3-carboxylic acid is sourced from PubChem (CID 116930077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).