C15H19NO6 — CID 120688788
3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]oxolane-3-carboxylic acid (PubChem CID 120688788) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120688788 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-[[2-(2,5-dimethoxyphenyl)acetyl]amino]oxolane-3-carboxylic acid |
| SMILES | COc1ccc(OC)c(CC(=O)NC2(C(=O)O)CCOC2)c1 |
| InChI | InChI=1S/C15H19NO6/c1-20-11-3-4-12(21-2)10(7-11)8-13(17)16-15(14(18)19)5-6-22-9-15/h3-4,7H,5-6,8-9H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | ZGUGXNKNTDXFRX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |