C16H18FNO6 — CID 120688787
3-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]oxolane-3-carboxylic acid (PubChem CID 120688787) has the molecular formula C16H18FNO6 and a molecular weight of 339.32 g/mol. Its IUPAC name is 3-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120688787 |
| Molecular Formula | C16H18FNO6 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3-[[4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoyl]amino]oxolane-3-carboxylic acid |
| SMILES | COc1ccc(C(=O)CCC(=O)NC2(C(=O)O)CCOC2)cc1F |
| InChI | InChI=1S/C16H18FNO6/c1-23-13-4-2-10(8-11(13)17)12(19)3-5-14(20)18-16(15(21)22)6-7-24-9-16/h2,4,8H,3,5-7,9H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | OXLIMEYQLAYPKW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |