C18H23NO6 — CID 120688779
3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]oxolane-3-carboxylic acid (PubChem CID 120688779) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120688779 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-[[4-oxo-4-(4-propoxyphenyl)butanoyl]amino]oxolane-3-carboxylic acid |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NC2(C(=O)O)CCOC2)cc1 |
| InChI | InChI=1S/C18H23NO6/c1-2-10-25-14-5-3-13(4-6-14)15(20)7-8-16(21)19-18(17(22)23)9-11-24-12-18/h3-6H,2,7-12H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | XWKQFPRFCWGNSV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |