C17H25NO3 — CID 78773838
N-butan-2-yl-4-oxo-4-(4-propoxyphenyl)butanamide (PubChem CID 78773838) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-butan-2-yl-4-oxo-4-(4-propoxyphenyl)butanamide.
| Compound Name | N-butan-2-yl-4-oxo-4-(4-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 78773838 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-butan-2-yl-4-oxo-4-(4-propoxyphenyl)butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)NC(C)CC)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-4-12-21-15-8-6-14(7-9-15)16(19)10-11-17(20)18-13(3)5-2/h6-9,13H,4-5,10-12H2,1-3H3,(H,18,20) |
| InChIKey | RUQVAOYOWIEZEN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |